3-CHLOROBENZO[B]THIOPHENE-2-CARBOXAMIDE

3-CHLOROBENZO[B]THIOPHENE-2-CARBOXAMIDE - Names and Identifiers

Name	3-Chlorobenzo[b]thiophene-2-carboxamide
Synonyms	3-Chlorobenzothiophene-2-carboxaMide 3-CHLOROBENZOTHIOPHENE-2-CARBOXAMIDE 3-Chlorobenzo[b]thiophene-2-carboxamide 3-chloro-1-benzothiophene-2-carboxamide 3-CHLOROBENZO[B]THIOPHENE-2-CARBOXAMIDE Benzo[b]thiophene-2-carboxamide, 3-chloro- 3-Chloro-benzo[b]thiophene-2-carboxylicacidamide
CAS	21211-09-6
EINECS	000-000-0
InChI	InChI=1/C9H6ClNOS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,(H2,11,12)

3-CHLOROBENZO[B]THIOPHENE-2-CARBOXAMIDE - Physico-chemical Properties

Molecular Formula	C9H6ClNOS
Molar Mass	211.67
Density	1.473g/cm³
Melting Point	234-236°C
Boling Point	392.7°C at 760 mmHg
Flash Point	191.3°C
Vapor Presure	2.25E-06mmHg at 25°C
BRN	1425601
Storage Condition	2-8°C
Refractive Index	1.712
MDL	MFCD00067793

3-CHLOROBENZO[B]THIOPHENE-2-CARBOXAMIDE - Risk and Safety

Hazard Symbols	Xi - Irritant
Risk Codes	36/37/38 - Irritating to eyes, respiratory system and skin.
Safety Description	S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection
HS Code	29349990

3-CHLOROBENZO[B]THIOPHENE-2-CARBOXAMIDE - Introduction

3-chorobenzo [B] thiophene-2-carboxamide is an organic compound with the chemical formula C10H6ClNOS.

Its main properties are as follows:
1. Appearance: 3-Chlorobenzo [B] thiophene-2-carboxamide are white to light yellow crystals.
2. Solubility: It is almost insoluble in water, but soluble in some organic solvents, such as dimethyl sulfoxide (DMSO), dichloromethane (DCM) and methanol.

The main uses of this compound are:
1. Chemical synthesis: 3-chorobenzo [B] thiophene-2-carboxamide can be used as an organic synthesis intermediate for the synthesis of other compounds or the preparation of target molecules.
2. Pharmaceutical field: compounds with polycyclic aromatic ketone structure often have biological activity, so 3-Chlorobenzo [B] thiophene-2-carboxamide may have potential medical applications.

The preparation method of 3-chorobenzo [B] thiophene-2-carboxamide usually involves the following steps:
1.3-chlorobenzo [B] thiophene and the amine compound (usually an amine salt) required for the reaction are reacted together to generate the corresponding amide.

Safety Information:
When using or handling 3-chorobenzo [B] thiophene-2-carboxamide, pay attention to the following safety precautions:
1. Avoid direct contact, especially contact with skin and eyes.
2. Use appropriate personal protective equipment during operation, such as lab gloves, goggles and lab clothes.
3. Operate in a well-ventilated place or use exhaust equipment.
4. Avoid inhaling the dust or vapor of the compound.

Last Update：2024-04-09 02:00:44